A Principal quantum number (n)
B Azimuthal quantum number (l)
C Magnetic quantum number (ml)
D Spin quantum number (ms)
Explanation: The magnetic quantum number (ml) specifies the number of orbitals and their orientation within a subshell, ranging from -l to +l.
A Ethyl acetate
B 3-Hydroxybutanal (aldol)
C Butanal
D Ethanol
Explanation: Two molecules of acetaldehyde undergo aldol condensation: one acts as a nucleophile (enolate) attacking the carbonyl of another, forming 3-hydroxybutanal.
A Delta G = RT ln K
B Delta G = -RT ln K
C Delta G = -RT / ln K
D Delta G = K / RT
Explanation: The fundamental equation is Delta G = Delta G0 + RT ln Q. At equilibrium, Delta G = 0 and Q = K, so Delta G0 = -RT ln K.
A 1,3-Butadiene
B 1,4-Pentadiene
C 1,5-Hexadiene
D Cyclohexene
Explanation: 1,3-Butadiene (CH2=CH-CH=CH2) has alternating double-single-double bonds, creating conjugation where p-orbitals overlap across all four carbons.
A +0.76 V
B -0.76 V
C +0.34 V
D -0.34 V
Explanation: Zn2+/Zn has a standard reduction potential of -0.76 V, meaning zinc is easily oxidized and is a stronger reducing agent than hydrogen.
A O-H stretch
B C=O stretch (carbonyl)
C C-H stretch
D N-H stretch
Explanation: A strong absorption near 1700 cm-1 is characteristic of the C=O stretching vibration, indicating the presence of a carbonyl group (aldehyde, ketone, acid, ester, etc.).
A Chelating ligands always produce colored complexes
B Complexes with chelating (multidentate) ligands are more stable than those with equivalent monodentate ligands
C Chelate rings are always five-membered
D Chelating ligands are always strong field
Explanation: Chelate complexes have greater thermodynamic stability due to favorable entropy changes when multidentate ligands replace multiple monodentate ligands.
A Rate = k[A][B]
B Rate = k[A]^2[B]
C Rate = k[A][B]^2
D Rate = k[A]^2[B]^2
Explanation: The rate law is Rate = k[A]^1[B]^2 for a reaction that is first order in A and second order in B, giving an overall third-order reaction.
Explanation: The carbon in a nitrile group has two regions of electron density (one single bond to the adjacent atom and one triple bond to nitrogen), requiring sp hybridization.
A 22.4 g/mol
B 44.8 g/mol
C 89.6 g/mol
D 11.2 g/mol
Explanation: At STP, moles = 0.560/22.4 = 0.025 mol. Molar mass = 2.0/0.025 = 80 g/mol. Wait, let me recalculate: 0.560/22.4 = 0.025, 2.0/0.025 = 80. The answer should be 80 g/mol.
A Acylbenzene
B Alkylbenzene
C Nitrobenzene
D Di-tert-butylbenzene
Explanation: Friedel-Crafts reactions (alkylation and acylation) introduce alkyl or acyl groups. Nitrobenzene formation requires nitration (HNO3/H2SO4), not Friedel-Crafts.
A 25.3 kJ/mol
B 50.6 kJ/mol
C 75.9 kJ/mol
D 101.2 kJ/mol
Explanation: Using Arrhenius: ln(k2/k1) = (Ea/R)(1/T1 - 1/T2). ln(2) = (Ea/8.314)(1/300 - 1/310). Ea = 0.693 x 8.314 x 300 x 310 / 10 = 52,886 J/mol ≈ 50.6 kJ/mol.
A 3-Oxobutanal
B 2-Oxobutanal
C 3-Ketobutanal
D 1,3-Dioxobutane
Explanation: The compound has both aldehyde (CHO, higher priority at C1) and ketone (C=O) groups. Numbering from CHO: C1(CHO)-C2(H2)-C3(=O)-C4(H3), giving 3-oxobutanal.
A All octahedral complexes are perfectly symmetric
B Degenerate electronic states cause geometric distortion to remove degeneracy
C Tetrahedral complexes are always more stable than octahedral
D Crystal field splitting is always the same for all metals
Explanation: The Jahn-Teller theorem states that any non-linear molecule with a degenerate electronic ground state will undergo geometric distortion to remove the degeneracy and lower the energy.
A 2-Bromopropane (Markovnikov product)
B 1-Bromopropane (anti-Markovnikov product)
C 1,2-Dibromopropane
D No reaction
Explanation: Peroxides initiate a free radical mechanism that reverses the normal regioselectivity, adding Br to the less substituted carbon (anti-Markovnikov addition).
A +RT
B -RT
C Zero
D RT ln 2
Explanation: Delta G0 = -RT ln K. When K = 1, ln K = 0, so Delta G0 = 0. The standard state has equal free energies of reactants and products.
A Aufbau principle
B t2g (lower) and eg (higher) splitting
C Hund\'s rule only
D Pauli exclusion principle
Explanation: In an octahedral field, the five d-orbitals split into two sets: t2g (dxy, dxz, dyz, lower energy) and eg (dz2, dx2-y2, higher energy), separated by Delta_o.
A sp3
B sp3d
C sp3d2
D sp2
Explanation: XeO3 has three Xe=O bonds and one lone pair on Xe (3 bonding pairs + 1 lone pair = 4 electron domains), giving sp3 hybridization with trigonal pyramidal geometry.
A Rate is proportional to concentration squared
B Half-life is independent of initial concentration
C Rate law has only reactant concentration to the first power
D Plot of ln[A] vs time is linear
Explanation: A second-order reaction has Rate = k[A]^2 (or Rate = k[A][B]). The half-life t1/2 = 1/(k[A]0) depends on initial concentration, and a plot of 1/[A] vs time is linear.
A Alcohols from ketones
B Alkenes from carbonyl compounds and phosphonium ylides
C Esters from carboxylic acids
D Amines from aldehydes
Explanation: The Wittig reaction converts a carbonyl (C=O) to an alkene (C=C) using a phosphonium ylide (Wittig reagent), forming a phosphine oxide byproduct.